C24H29N5O2 — CID 129324498
5-(4-hydroxypiperidin-1-yl)-2-[(3S)-1-(quinolin-2-ylmethyl)piperidin-3-yl]pyridazin-3-one (PubChem CID 129324498) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 5-(4-hydroxypiperidin-1-yl)-2-[(3S)-1-(quinolin-2-ylmethyl)piperidin-3-yl]pyridazin-3-one.
| Compound Name | 5-(4-hydroxypiperidin-1-yl)-2-[(3S)-1-(quinolin-2-ylmethyl)piperidin-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 129324498 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 5-(4-hydroxypiperidin-1-yl)-2-[(3S)-1-(quinolin-2-ylmethyl)piperidin-3-yl]pyridazin-3-one |
| SMILES | O=c1cc(N2CCC(O)CC2)cnn1[C@H]1CCCN(Cc2ccc3ccccc3n2)C1 |
| InChI | InChI=1S/C24H29N5O2/c30-22-9-12-28(13-10-22)21-14-24(31)29(25-15-21)20-5-3-11-27(17-20)16-19-8-7-18-4-1-2-6-23(18)26-19/h1-2,4,6-8,14-15,20,22,30H,3,5,9-13,16-17H2/t20-/m0/s1 |
| InChIKey | NSUDEHCXOFNJKX-FQEVSTJZSA-N |
| XLogP | 2.59 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |