C22H26N4O3 — CID 129323592
2-[(3S)-1-(1-benzofuran-3-ylmethyl)piperidin-3-yl]-5-morpholin-4-ylpyridazin-3-one (PubChem CID 129323592) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[(3S)-1-(1-benzofuran-3-ylmethyl)piperidin-3-yl]-5-morpholin-4-ylpyridazin-3-one.
| Compound Name | 2-[(3S)-1-(1-benzofuran-3-ylmethyl)piperidin-3-yl]-5-morpholin-4-ylpyridazin-3-one |
|---|---|
| PubChem CID | 129323592 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[(3S)-1-(1-benzofuran-3-ylmethyl)piperidin-3-yl]-5-morpholin-4-ylpyridazin-3-one |
| SMILES | O=c1cc(N2CCOCC2)cnn1[C@H]1CCCN(Cc2coc3ccccc23)C1 |
| InChI | InChI=1S/C22H26N4O3/c27-22-12-19(25-8-10-28-11-9-25)13-23-26(22)18-4-3-7-24(15-18)14-17-16-29-21-6-2-1-5-20(17)21/h1-2,5-6,12-13,16,18H,3-4,7-11,14-15H2/t18-/m0/s1 |
| InChIKey | CEFYGCVITBNSPF-SFHVURJKSA-N |
| XLogP | 2.66 |
| TPSA | 63.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |