C23H27N3O3 — CID 110219603
3-[1-[(4-morpholin-4-ylphenyl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one (PubChem CID 110219603) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-[1-[(4-morpholin-4-ylphenyl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[1-[(4-morpholin-4-ylphenyl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110219603 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 3-[1-[(4-morpholin-4-ylphenyl)methyl]piperidin-3-yl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1C1CCCN(Cc2ccc(N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C23H27N3O3/c27-23-26(21-5-1-2-6-22(21)29-23)20-4-3-11-24(17-20)16-18-7-9-19(10-8-18)25-12-14-28-15-13-25/h1-2,5-10,20H,3-4,11-17H2 |
| InChIKey | JVFUAEVACDRRMD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|