C23H28N4O — CID 123895819
4-[4-[(3-indazol-1-ylpiperidin-1-yl)methyl]phenyl]morpholine (PubChem CID 123895819) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-[4-[(3-indazol-1-ylpiperidin-1-yl)methyl]phenyl]morpholine.
| Compound Name | 4-[4-[(3-indazol-1-ylpiperidin-1-yl)methyl]phenyl]morpholine |
|---|---|
| PubChem CID | 123895819 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 4-[4-[(3-indazol-1-ylpiperidin-1-yl)methyl]phenyl]morpholine |
| SMILES | c1ccc2c(c1)cnn2C1CCCN(Cc2ccc(N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C23H28N4O/c1-2-6-23-20(4-1)16-24-27(23)22-5-3-11-25(18-22)17-19-7-9-21(10-8-19)26-12-14-28-15-13-26/h1-2,4,6-10,16,22H,3,5,11-15,17-18H2 |
| InChIKey | YEVFEZCRNJKBAS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|