C20H21N5 — CID 122451774
3-(1-benzylpiperidin-3-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene (PubChem CID 122451774) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-(1-benzylpiperidin-3-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene.
| Compound Name | 3-(1-benzylpiperidin-3-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 122451774 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 3-(1-benzylpiperidin-3-yl)-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaene |
| SMILES | C1=Nc2ncc3cnn(C4CCCN(Cc5ccccc5)C4)c3c2C1 |
| InChI | InChI=1S/C20H21N5/c1-2-5-15(6-3-1)13-24-10-4-7-17(14-24)25-19-16(12-23-25)11-22-20-18(19)8-9-21-20/h1-3,5-6,9,11-12,17H,4,7-8,10,13-14H2 |
| InChIKey | QYAPXEPXTPVUIW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |