C19H28N6O3 — CID 129326259
N-[2-(cyclohexen-1-yl)ethyl]-2-[(4R)-2,5-dioxo-4-[(1-propan-2-yltriazol-4-yl)methyl]imidazolidin-1-yl]acetamide (PubChem CID 129326259) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(4R)-2,5-dioxo-4-[(1-propan-2-yltriazol-4-yl)methyl]imidazolidin-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(4R)-2,5-dioxo-4-[(1-propan-2-yltriazol-4-yl)methyl]imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 129326259 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(4R)-2,5-dioxo-4-[(1-propan-2-yltriazol-4-yl)methyl]imidazolidin-1-yl]acetamide |
| SMILES | CC(C)n1cc(C[C@H]2NC(=O)N(CC(=O)NCCC3=CCCCC3)C2=O)nn1 |
| InChI | InChI=1S/C19H28N6O3/c1-13(2)25-11-15(22-23-25)10-16-18(27)24(19(28)21-16)12-17(26)20-9-8-14-6-4-3-5-7-14/h6,11,13,16H,3-5,7-10,12H2,1-2H3,(H,20,26)(H,21,28)/t16-/m1/s1 |
| InChIKey | IJGBWCZIJSQGSE-MRXNPFEDSA-N |
| XLogP | 1.33 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|