C17H21N3O3S — CID 129327024
[(2R,4S)-4-hydroxy-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methanone (PubChem CID 129327024) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(2R,4S)-4-hydroxy-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methanone.
| Compound Name | [(2R,4S)-4-hydroxy-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methanone |
|---|---|
| PubChem CID | 129327024 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(2R,4S)-4-hydroxy-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]-[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]methanone |
| SMILES | Cc1noc([C@H]2C[C@H](O)CN2C(=O)c2csc3c2CC[C@@H](C)C3)n1 |
| InChI | InChI=1S/C17H21N3O3S/c1-9-3-4-12-13(8-24-15(12)5-9)17(22)20-7-11(21)6-14(20)16-18-10(2)19-23-16/h8-9,11,14,21H,3-7H2,1-2H3/t9-,11+,14-/m1/s1 |
| InChIKey | PMLYPOBGKFYTEV-OLUVUFQESA-N |
| XLogP | 2.51 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |