C13H12F3N3O4S — CID 129327157
(3R)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-(2,4,5-trifluorophenyl)sulfonylpyrrolidin-3-ol (PubChem CID 129327157) has the molecular formula C13H12F3N3O4S and a molecular weight of 363.32 g/mol. Its IUPAC name is (3R)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-(2,4,5-trifluorophenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-(2,4,5-trifluorophenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 129327157 |
| Molecular Formula | C13H12F3N3O4S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (3R)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-(2,4,5-trifluorophenyl)sulfonylpyrrolidin-3-ol |
| SMILES | Cc1noc([C@@]2(O)CCN(S(=O)(=O)c3cc(F)c(F)cc3F)C2)n1 |
| InChI | InChI=1S/C13H12F3N3O4S/c1-7-17-12(23-18-7)13(20)2-3-19(6-13)24(21,22)11-5-9(15)8(14)4-10(11)16/h4-5,20H,2-3,6H2,1H3/t13-/m1/s1 |
| InChIKey | QPOHWMFHOFGLAZ-CYBMUJFWSA-N |
| XLogP | 1.08 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|