C16H18N6O — CID 129328621
[(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-(1H-indazol-3-yl)methanone (PubChem CID 129328621) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is [(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-(1H-indazol-3-yl)methanone.
| Compound Name | [(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 129328621 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-(1H-indazol-3-yl)methanone |
| SMILES | CN1CCN(C(=O)c2n[nH]c3ccccc23)C[C@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C16H18N6O/c1-21-8-9-22(10-13(21)15-17-6-7-18-15)16(23)14-11-4-2-3-5-12(11)19-20-14/h2-7,13H,8-10H2,1H3,(H,17,18)(H,19,20)/t13-/m0/s1 |
| InChIKey | BVXKOEUNDRPZSA-ZDUSSCGKSA-N |
| XLogP | 1.41 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |