C13H16N4OS — CID 129337486
[(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-thiophen-3-ylmethanone (PubChem CID 129337486) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is [(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 129337486 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [(3S)-3-(1H-imidazol-2-yl)-4-methylpiperazin-1-yl]-thiophen-3-ylmethanone |
| SMILES | CN1CCN(C(=O)c2ccsc2)C[C@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C13H16N4OS/c1-16-5-6-17(13(18)10-2-7-19-9-10)8-11(16)12-14-3-4-15-12/h2-4,7,9,11H,5-6,8H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | SJJIVLSJRZSIHH-NSHDSACASA-N |
| XLogP | 1.60 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |