About N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide
N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide (PubChem CID 129330943) has the molecular formula C14H19N5OS
and a molecular weight of 305.41 g/mol. Its IUPAC name is N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide |
| PubChem CID | 129330943 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide |
| SMILES | Cc1ncsc1CNC(=O)c1ccn([C@H]2CCCNC2)n1 |
| InChI | InChI=1S/C14H19N5OS/c1-10-13(21-9-17-10)8-16-14(20)12-4-6-19(18-12)11-3-2-5-15-7-11/h4,6,9,11,15H,2-3,5,7-8H2,1H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | IQDNTVFGOWVMJQ-NSHDSACASA-N |
| XLogP | 1.50 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide?
The IUPAC name of N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide (CID 129330943) is N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide.
What is the SMILES notation for N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide?
The canonical SMILES for N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide is Cc1ncsc1CNC(=O)c1ccn([C@H]2CCCNC2)n1.
What is the InChIKey of N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide?
The InChIKey is IQDNTVFGOWVMJQ-NSHDSACASA-N. The full InChI is InChI=1S/C14H19N5OS/c1-10-13(21-9-17-10)8-16-14(20)12-4-6-19(18-12)11-3-2-5-15-7-11/h4,6,9,11,15H,2-3,5,7-8H2,1H3,(H,16,20)/t11-/m0/s1.
What are the key properties of N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide?
N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide has a molecular weight of 305.41 g/mol, XLogP of 1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-[(3S)-piperidin-3-yl]pyrazole-3-carboxamide is sourced from PubChem (CID 129330943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).