C15H20F3N3O2 — CID 129332189
(2S,3R)-3-methyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]oxolane-2-carboxamide (PubChem CID 129332189) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is (2S,3R)-3-methyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]oxolane-2-carboxamide.
| Compound Name | (2S,3R)-3-methyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 129332189 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (2S,3R)-3-methyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]oxolane-2-carboxamide |
| SMILES | C[C@@H]1CCO[C@@H]1C(=O)NC[C@@H]1CCc2nc(C(F)(F)F)cn2C1 |
| InChI | InChI=1S/C15H20F3N3O2/c1-9-4-5-23-13(9)14(22)19-6-10-2-3-12-20-11(15(16,17)18)8-21(12)7-10/h8-10,13H,2-7H2,1H3,(H,19,22)/t9-,10+,13+/m1/s1 |
| InChIKey | KOKVALWLYPHZBP-NRUUGDAUSA-N |
| XLogP | 2.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |