C19H28N2O3S — CID 129333224
N-cyclobutyl-N-[(4R)-1-(3-methylbenzoyl)azepan-4-yl]methanesulfonamide (PubChem CID 129333224) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is N-cyclobutyl-N-[(4R)-1-(3-methylbenzoyl)azepan-4-yl]methanesulfonamide.
| Compound Name | N-cyclobutyl-N-[(4R)-1-(3-methylbenzoyl)azepan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 129333224 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-cyclobutyl-N-[(4R)-1-(3-methylbenzoyl)azepan-4-yl]methanesulfonamide |
| SMILES | Cc1cccc(C(=O)N2CCC[C@@H](N(C3CCC3)S(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C19H28N2O3S/c1-15-6-3-7-16(14-15)19(22)20-12-5-10-18(11-13-20)21(25(2,23)24)17-8-4-9-17/h3,6-7,14,17-18H,4-5,8-13H2,1-2H3/t18-/m1/s1 |
| InChIKey | FITNPMNURXFDCT-GOSISDBHSA-N |
| XLogP | 2.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |