C17H25N3O4S — CID 128992384
N-cyclobutyl-N-[1-(2-oxo-1H-pyridine-3-carbonyl)azepan-4-yl]methanesulfonamide (PubChem CID 128992384) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-cyclobutyl-N-[1-(2-oxo-1H-pyridine-3-carbonyl)azepan-4-yl]methanesulfonamide.
| Compound Name | N-cyclobutyl-N-[1-(2-oxo-1H-pyridine-3-carbonyl)azepan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 128992384 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-cyclobutyl-N-[1-(2-oxo-1H-pyridine-3-carbonyl)azepan-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(C1CCC1)C1CCCN(C(=O)c2ccc[nH]c2=O)CC1 |
| InChI | InChI=1S/C17H25N3O4S/c1-25(23,24)20(13-5-2-6-13)14-7-4-11-19(12-9-14)17(22)15-8-3-10-18-16(15)21/h3,8,10,13-14H,2,4-7,9,11-12H2,1H3,(H,18,21) |
| InChIKey | DGPHZVAQVLKJIJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |