C13H17N5O2 — CID 129333685
1-(4-methyl-1,2-oxazol-3-yl)-3-[[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]urea (PubChem CID 129333685) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(4-methyl-1,2-oxazol-3-yl)-3-[[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]urea.
| Compound Name | 1-(4-methyl-1,2-oxazol-3-yl)-3-[[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]urea |
|---|---|
| PubChem CID | 129333685 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-(4-methyl-1,2-oxazol-3-yl)-3-[[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]urea |
| SMILES | Cc1conc1NC(=O)NC[C@@H]1CCc2nccn2C1 |
| InChI | InChI=1S/C13H17N5O2/c1-9-8-20-17-12(9)16-13(19)15-6-10-2-3-11-14-4-5-18(11)7-10/h4-5,8,10H,2-3,6-7H2,1H3,(H2,15,16,17,19)/t10-/m0/s1 |
| InChIKey | MQPKGGOGTOXCQK-JTQLQIEISA-N |
| XLogP | 1.56 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |