C14H19N5O2 — CID 129328569
1-methyl-3-(4-methyl-1,2-oxazol-3-yl)-1-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]urea (PubChem CID 129328569) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-methyl-3-(4-methyl-1,2-oxazol-3-yl)-1-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]urea.
| Compound Name | 1-methyl-3-(4-methyl-1,2-oxazol-3-yl)-1-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]urea |
|---|---|
| PubChem CID | 129328569 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-methyl-3-(4-methyl-1,2-oxazol-3-yl)-1-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]urea |
| SMILES | Cc1conc1NC(=O)N(C)C[C@H]1CCn2ccnc2C1 |
| InChI | InChI=1S/C14H19N5O2/c1-10-9-21-17-13(10)16-14(20)18(2)8-11-3-5-19-6-4-15-12(19)7-11/h4,6,9,11H,3,5,7-8H2,1-2H3,(H,16,17,20)/t11-/m0/s1 |
| InChIKey | BRPUHDOTIRFMCW-NSHDSACASA-N |
| XLogP | 1.91 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |