C15H20F3N5 — CID 129333757
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1-[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methanamine (PubChem CID 129333757) has the molecular formula C15H20F3N5 and a molecular weight of 327.35 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1-[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methanamine.
| Compound Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1-[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 129333757 |
| Molecular Formula | C15H20F3N5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1-[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methanamine |
| SMILES | Cc1n[nH]c(C)c1CNC[C@@H]1CCc2nc(C(F)(F)F)cn2C1 |
| InChI | InChI=1S/C15H20F3N5/c1-9-12(10(2)22-21-9)6-19-5-11-3-4-14-20-13(15(16,17)18)8-23(14)7-11/h8,11,19H,3-7H2,1-2H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | GDNMKCOIQVPILE-NSHDSACASA-N |
| XLogP | 2.59 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |