C15H18F3N5 — CID 129340505
5,6-dimethyl-N-[[(6R)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyridazin-3-amine (PubChem CID 129340505) has the molecular formula C15H18F3N5 and a molecular weight of 325.34 g/mol. Its IUPAC name is 5,6-dimethyl-N-[[(6R)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyridazin-3-amine.
| Compound Name | 5,6-dimethyl-N-[[(6R)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 129340505 |
| Molecular Formula | C15H18F3N5 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 5,6-dimethyl-N-[[(6R)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyridazin-3-amine |
| SMILES | Cc1cc(NC[C@H]2CCc3nc(C(F)(F)F)cn3C2)nnc1C |
| InChI | InChI=1S/C15H18F3N5/c1-9-5-13(22-21-10(9)2)19-6-11-3-4-14-20-12(15(16,17)18)8-23(14)7-11/h5,8,11H,3-4,6-7H2,1-2H3,(H,19,22)/t11-/m1/s1 |
| InChIKey | XKLUXWSACUVTRX-LLVKDONJSA-N |
| XLogP | 2.98 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |