C16H17F3N6 — CID 129334996
5,6-dimethyl-3-[[(6R)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methylamino]pyridazine-4-carbonitrile (PubChem CID 129334996) has the molecular formula C16H17F3N6 and a molecular weight of 350.35 g/mol. Its IUPAC name is 5,6-dimethyl-3-[[(6R)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methylamino]pyridazine-4-carbonitrile.
| Compound Name | 5,6-dimethyl-3-[[(6R)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 129334996 |
| Molecular Formula | C16H17F3N6 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 5,6-dimethyl-3-[[(6R)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methylamino]pyridazine-4-carbonitrile |
| SMILES | Cc1nnc(NC[C@H]2CCc3nc(C(F)(F)F)cn3C2)c(C#N)c1C |
| InChI | InChI=1S/C16H17F3N6/c1-9-10(2)23-24-15(12(9)5-20)21-6-11-3-4-14-22-13(16(17,18)19)8-25(14)7-11/h8,11H,3-4,6-7H2,1-2H3,(H,21,24)/t11-/m1/s1 |
| InChIKey | ONHJOXNKHFXMDZ-LLVKDONJSA-N |
| XLogP | 2.85 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |