C14H19N5O2S — CID 129335126
1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[[(4R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]urea (PubChem CID 129335126) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[[(4R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]urea.
| Compound Name | 1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[[(4R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]urea |
|---|---|
| PubChem CID | 129335126 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[[(4R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]urea |
| SMILES | Cc1nc(CNC(=O)NC[C@H]2CCCc3sc(C)nc32)no1 |
| InChI | InChI=1S/C14H19N5O2S/c1-8-17-12(19-21-8)7-16-14(20)15-6-10-4-3-5-11-13(10)18-9(2)22-11/h10H,3-7H2,1-2H3,(H2,15,16,20)/t10-/m1/s1 |
| InChIKey | ORNGPPVAGNQNAV-SNVBAGLBSA-N |
| XLogP | 2.06 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |