C16H21N3O2S — CID 128967867
N,3,5-trimethyl-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]-1,2-oxazole-4-carboxamide (PubChem CID 128967867) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is N,3,5-trimethyl-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]-1,2-oxazole-4-carboxamide.
| Compound Name | N,3,5-trimethyl-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 128967867 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N,3,5-trimethyl-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1nc2c(s1)CCCC2CN(C)C(=O)c1c(C)noc1C |
| InChI | InChI=1S/C16H21N3O2S/c1-9-14(10(2)21-18-9)16(20)19(4)8-12-6-5-7-13-15(12)17-11(3)22-13/h12H,5-8H2,1-4H3 |
| InChIKey | ZNZZDEXQSQOMRQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |