C14H26N4O2 — CID 129335737
(2R)-2-(4-ethyl-1,2,4-triazol-3-yl)-4-(3-propan-2-yloxypropyl)morpholine (PubChem CID 129335737) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is (2R)-2-(4-ethyl-1,2,4-triazol-3-yl)-4-(3-propan-2-yloxypropyl)morpholine.
| Compound Name | (2R)-2-(4-ethyl-1,2,4-triazol-3-yl)-4-(3-propan-2-yloxypropyl)morpholine |
|---|---|
| PubChem CID | 129335737 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (2R)-2-(4-ethyl-1,2,4-triazol-3-yl)-4-(3-propan-2-yloxypropyl)morpholine |
| SMILES | CCn1cnnc1[C@H]1CN(CCCOC(C)C)CCO1 |
| InChI | InChI=1S/C14H26N4O2/c1-4-18-11-15-16-14(18)13-10-17(7-9-20-13)6-5-8-19-12(2)3/h11-13H,4-10H2,1-3H3/t13-/m1/s1 |
| InChIKey | JEICPWNEVIQVBW-CYBMUJFWSA-N |
| XLogP | 1.49 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|