C18H26N4O2 — CID 129342344
(2R)-4-[3-(2,6-dimethylphenoxy)propyl]-2-(4-methyl-1,2,4-triazol-3-yl)morpholine (PubChem CID 129342344) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2R)-4-[3-(2,6-dimethylphenoxy)propyl]-2-(4-methyl-1,2,4-triazol-3-yl)morpholine.
| Compound Name | (2R)-4-[3-(2,6-dimethylphenoxy)propyl]-2-(4-methyl-1,2,4-triazol-3-yl)morpholine |
|---|---|
| PubChem CID | 129342344 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (2R)-4-[3-(2,6-dimethylphenoxy)propyl]-2-(4-methyl-1,2,4-triazol-3-yl)morpholine |
| SMILES | Cc1cccc(C)c1OCCCN1CCO[C@@H](c2nncn2C)C1 |
| InChI | InChI=1S/C18H26N4O2/c1-14-6-4-7-15(2)17(14)24-10-5-8-22-9-11-23-16(12-22)18-20-19-13-21(18)3/h4,6-7,13,16H,5,8-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | SWUUJDAHEKIFSQ-MRXNPFEDSA-N |
| XLogP | 2.27 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|