C19H24N6 — CID 129337104
2-[(4R)-4-[[6-(dimethylamino)-3-pyridinyl]amino]azepan-1-yl]pyridine-3-carbonitrile (PubChem CID 129337104) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[(4R)-4-[[6-(dimethylamino)-3-pyridinyl]amino]azepan-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[(4R)-4-[[6-(dimethylamino)-3-pyridinyl]amino]azepan-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 129337104 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-[(4R)-4-[[6-(dimethylamino)-3-pyridinyl]amino]azepan-1-yl]pyridine-3-carbonitrile |
| SMILES | CN(C)c1ccc(N[C@@H]2CCCN(c3ncccc3C#N)CC2)cn1 |
| InChI | InChI=1S/C19H24N6/c1-24(2)18-8-7-17(14-22-18)23-16-6-4-11-25(12-9-16)19-15(13-20)5-3-10-21-19/h3,5,7-8,10,14,16,23H,4,6,9,11-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | LFNULVFTSZXSCV-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |