C16H17ClN6 — CID 135087837
2-[4-[(5-chloro-2-methylpyrimidin-4-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 135087837) has the molecular formula C16H17ClN6 and a molecular weight of 328.81 g/mol. Its IUPAC name is 2-[4-[(5-chloro-2-methylpyrimidin-4-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-[(5-chloro-2-methylpyrimidin-4-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135087837 |
| Molecular Formula | C16H17ClN6 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[4-[(5-chloro-2-methylpyrimidin-4-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | Cc1ncc(Cl)c(NC2CCN(c3ncccc3C#N)CC2)n1 |
| InChI | InChI=1S/C16H17ClN6/c1-11-20-10-14(17)15(21-11)22-13-4-7-23(8-5-13)16-12(9-18)3-2-6-19-16/h2-3,6,10,13H,4-5,7-8H2,1H3,(H,20,21,22) |
| InChIKey | PWECWFNWFTXATH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |