C16H18N6O2S — CID 72892481
2-[4-(2-methyl-5-methylsulfonylpyrimidin-4-yl)piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 72892481) has the molecular formula C16H18N6O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is 2-[4-(2-methyl-5-methylsulfonylpyrimidin-4-yl)piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-(2-methyl-5-methylsulfonylpyrimidin-4-yl)piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 72892481 |
| Molecular Formula | C16H18N6O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[4-(2-methyl-5-methylsulfonylpyrimidin-4-yl)piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | Cc1ncc(S(C)(=O)=O)c(N2CCN(c3ncccc3C#N)CC2)n1 |
| InChI | InChI=1S/C16H18N6O2S/c1-12-19-11-14(25(2,23)24)16(20-12)22-8-6-21(7-9-22)15-13(10-17)4-3-5-18-15/h3-5,11H,6-9H2,1-2H3 |
| InChIKey | KHQORQWNGWGOEI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 103.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |