C21H28N4O3 — CID 129337128
N-[(4R)-1-[3-(5-methylfuran-2-yl)propanoyl]azepan-4-yl]-N-(pyrimidin-5-ylmethyl)acetamide (PubChem CID 129337128) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[(4R)-1-[3-(5-methylfuran-2-yl)propanoyl]azepan-4-yl]-N-(pyrimidin-5-ylmethyl)acetamide.
| Compound Name | N-[(4R)-1-[3-(5-methylfuran-2-yl)propanoyl]azepan-4-yl]-N-(pyrimidin-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 129337128 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[(4R)-1-[3-(5-methylfuran-2-yl)propanoyl]azepan-4-yl]-N-(pyrimidin-5-ylmethyl)acetamide |
| SMILES | CC(=O)N(Cc1cncnc1)[C@@H]1CCCN(C(=O)CCc2ccc(C)o2)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-16-5-6-20(28-16)7-8-21(27)24-10-3-4-19(9-11-24)25(17(2)26)14-18-12-22-15-23-13-18/h5-6,12-13,15,19H,3-4,7-11,14H2,1-2H3/t19-/m1/s1 |
| InChIKey | LHIFOSFSUMOSRW-LJQANCHMSA-N |
| XLogP | 2.74 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |