C14H18N4OS — CID 129338410
4-N-[(3R)-oxan-3-yl]-2-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 129338410) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-N-[(3R)-oxan-3-yl]-2-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3R)-oxan-3-yl]-2-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 129338410 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-N-[(3R)-oxan-3-yl]-2-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | c1csc(CNc2nccc(N[C@@H]3CCCOC3)n2)c1 |
| InChI | InChI=1S/C14H18N4OS/c1-3-11(10-19-7-1)17-13-5-6-15-14(18-13)16-9-12-4-2-8-20-12/h2,4-6,8,11H,1,3,7,9-10H2,(H2,15,16,17,18)/t11-/m1/s1 |
| InChIKey | MZKVYEIHYMUKHN-LLVKDONJSA-N |
| XLogP | 2.74 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |