C14H20N6O — CID 129341030
2-N-(2-imidazol-1-ylethyl)-4-N-[(3R)-oxan-3-yl]pyrimidine-2,4-diamine (PubChem CID 129341030) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-N-(2-imidazol-1-ylethyl)-4-N-[(3R)-oxan-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-imidazol-1-ylethyl)-4-N-[(3R)-oxan-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 129341030 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-N-(2-imidazol-1-ylethyl)-4-N-[(3R)-oxan-3-yl]pyrimidine-2,4-diamine |
| SMILES | c1cn(CCNc2nccc(N[C@@H]3CCCOC3)n2)cn1 |
| InChI | InChI=1S/C14H20N6O/c1-2-12(10-21-9-1)18-13-3-4-16-14(19-13)17-6-8-20-7-5-15-11-20/h3-5,7,11-12H,1-2,6,8-10H2,(H2,16,17,18,19)/t12-/m1/s1 |
| InChIKey | QXMFEEGZJTWMGV-GFCCVEGCSA-N |
| XLogP | 1.38 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |