C16H22N4OS — CID 129338796
1-[(3R)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 129338796) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 1-[(3R)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(3R)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 129338796 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[(3R)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | CCN1CCN(C(=O)Cc2cccs2)C[C@@H]1c1nccn1C |
| InChI | InChI=1S/C16H22N4OS/c1-3-19-8-9-20(15(21)11-13-5-4-10-22-13)12-14(19)16-17-6-7-18(16)2/h4-7,10,14H,3,8-9,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | UXULHVPSJNVFND-CQSZACIVSA-N |
| XLogP | 1.93 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |