C17H28N4O2 — CID 129335910
1-[(3R)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(1-hydroxycyclopentyl)ethanone (PubChem CID 129335910) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-[(3R)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(1-hydroxycyclopentyl)ethanone.
| Compound Name | 1-[(3R)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(1-hydroxycyclopentyl)ethanone |
|---|---|
| PubChem CID | 129335910 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-[(3R)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-2-(1-hydroxycyclopentyl)ethanone |
| SMILES | CCN1CCN(C(=O)CC2(O)CCCC2)C[C@@H]1c1nccn1C |
| InChI | InChI=1S/C17H28N4O2/c1-3-20-10-11-21(13-14(20)16-18-8-9-19(16)2)15(22)12-17(23)6-4-5-7-17/h8-9,14,23H,3-7,10-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | PUXJBDKXKONPEN-CQSZACIVSA-N |
| XLogP | 1.32 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |