C18H30N4O2 — CID 129330947
1-[(3S)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-3-[(3S)-oxan-3-yl]propan-1-one (PubChem CID 129330947) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[(3S)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-3-[(3S)-oxan-3-yl]propan-1-one.
| Compound Name | 1-[(3S)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-3-[(3S)-oxan-3-yl]propan-1-one |
|---|---|
| PubChem CID | 129330947 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1-[(3S)-4-ethyl-3-(1-methylimidazol-2-yl)piperazin-1-yl]-3-[(3S)-oxan-3-yl]propan-1-one |
| SMILES | CCN1CCN(C(=O)CC[C@@H]2CCCOC2)C[C@H]1c1nccn1C |
| InChI | InChI=1S/C18H30N4O2/c1-3-21-10-11-22(13-16(21)18-19-8-9-20(18)2)17(23)7-6-15-5-4-12-24-14-15/h8-9,15-16H,3-7,10-14H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | IQKWTTVJGGLNOS-HOTGVXAUSA-N |
| XLogP | 1.83 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |