C17H23N7O — CID 129342255
N-[(1R)-cyclohex-2-en-1-yl]-4-(2-methyl-[1,2,4]triazolo[1,5-a]pyrazin-5-yl)piperazine-1-carboxamide (PubChem CID 129342255) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[(1R)-cyclohex-2-en-1-yl]-4-(2-methyl-[1,2,4]triazolo[1,5-a]pyrazin-5-yl)piperazine-1-carboxamide.
| Compound Name | N-[(1R)-cyclohex-2-en-1-yl]-4-(2-methyl-[1,2,4]triazolo[1,5-a]pyrazin-5-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 129342255 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N-[(1R)-cyclohex-2-en-1-yl]-4-(2-methyl-[1,2,4]triazolo[1,5-a]pyrazin-5-yl)piperazine-1-carboxamide |
| SMILES | Cc1nc2cncc(N3CCN(C(=O)N[C@H]4C=CCCC4)CC3)n2n1 |
| InChI | InChI=1S/C17H23N7O/c1-13-19-15-11-18-12-16(24(15)21-13)22-7-9-23(10-8-22)17(25)20-14-5-3-2-4-6-14/h3,5,11-12,14H,2,4,6-10H2,1H3,(H,20,25)/t14-/m0/s1 |
| InChIKey | SPMCHENCIQSQJV-AWEZNQCLSA-N |
| XLogP | 1.37 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|