C16H21N7O — CID 129003660
N-cyclohex-2-en-1-yl-4-([1,2,4]triazolo[1,5-a]pyrazin-5-yl)piperazine-1-carboxamide (PubChem CID 129003660) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-4-([1,2,4]triazolo[1,5-a]pyrazin-5-yl)piperazine-1-carboxamide.
| Compound Name | N-cyclohex-2-en-1-yl-4-([1,2,4]triazolo[1,5-a]pyrazin-5-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 129003660 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-cyclohex-2-en-1-yl-4-([1,2,4]triazolo[1,5-a]pyrazin-5-yl)piperazine-1-carboxamide |
| SMILES | O=C(NC1C=CCCC1)N1CCN(c2cncc3ncnn23)CC1 |
| InChI | InChI=1S/C16H21N7O/c24-16(20-13-4-2-1-3-5-13)22-8-6-21(7-9-22)15-11-17-10-14-18-12-19-23(14)15/h2,4,10-13H,1,3,5-9H2,(H,20,24) |
| InChIKey | VWAIDJNWZTYVLF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|