C20H22FN5O2 — CID 155914277
N-cyclohex-2-en-1-yl-7-(5-fluoropyridine-3-carbonyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide (PubChem CID 155914277) has the molecular formula C20H22FN5O2 and a molecular weight of 383.43 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-7-(5-fluoropyridine-3-carbonyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide.
| Compound Name | N-cyclohex-2-en-1-yl-7-(5-fluoropyridine-3-carbonyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 155914277 |
| Molecular Formula | C20H22FN5O2 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-cyclohex-2-en-1-yl-7-(5-fluoropyridine-3-carbonyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-2-carboxamide |
| SMILES | O=C(NC1C=CCCC1)c1cn2c(n1)CCN(C(=O)c1cncc(F)c1)CC2 |
| InChI | InChI=1S/C20H22FN5O2/c21-15-10-14(11-22-12-15)20(28)25-7-6-18-24-17(13-26(18)9-8-25)19(27)23-16-4-2-1-3-5-16/h2,4,10-13,16H,1,3,5-9H2,(H,23,27) |
| InChIKey | QVRWYPANJAOCTB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|