C16H28N2O6S — CID 129343019
2-[(1-methylsulfonylpiperidin-4-yl)-[3-[(3R)-oxan-3-yl]propanoyl]amino]acetic acid (PubChem CID 129343019) has the molecular formula C16H28N2O6S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[(1-methylsulfonylpiperidin-4-yl)-[3-[(3R)-oxan-3-yl]propanoyl]amino]acetic acid.
| Compound Name | 2-[(1-methylsulfonylpiperidin-4-yl)-[3-[(3R)-oxan-3-yl]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 129343019 |
| Molecular Formula | C16H28N2O6S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[(1-methylsulfonylpiperidin-4-yl)-[3-[(3R)-oxan-3-yl]propanoyl]amino]acetic acid |
| SMILES | CS(=O)(=O)N1CCC(N(CC(=O)O)C(=O)CC[C@H]2CCCOC2)CC1 |
| InChI | InChI=1S/C16H28N2O6S/c1-25(22,23)17-8-6-14(7-9-17)18(11-16(20)21)15(19)5-4-13-3-2-10-24-12-13/h13-14H,2-12H2,1H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | VTOXTAITNBKJME-CYBMUJFWSA-N |
| XLogP | 0.53 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |