C12H16N2O2S — CID 129345042
(3R)-3-methyl-1-[3-(1,3-thiazol-2-yl)propanoyl]piperidin-4-one (PubChem CID 129345042) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is (3R)-3-methyl-1-[3-(1,3-thiazol-2-yl)propanoyl]piperidin-4-one.
| Compound Name | (3R)-3-methyl-1-[3-(1,3-thiazol-2-yl)propanoyl]piperidin-4-one |
|---|---|
| PubChem CID | 129345042 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (3R)-3-methyl-1-[3-(1,3-thiazol-2-yl)propanoyl]piperidin-4-one |
| SMILES | C[C@@H]1CN(C(=O)CCc2nccs2)CCC1=O |
| InChI | InChI=1S/C12H16N2O2S/c1-9-8-14(6-4-10(9)15)12(16)3-2-11-13-5-7-17-11/h5,7,9H,2-4,6,8H2,1H3/t9-/m1/s1 |
| InChIKey | YJXMPOOOMKTBHD-SECBINFHSA-N |
| XLogP | 1.51 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |