C10H13F2NO2 — CID 129349310
(3R)-3-(difluoromethyl)-1-(furan-2-ylmethyl)pyrrolidin-3-ol (PubChem CID 129349310) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is (3R)-3-(difluoromethyl)-1-(furan-2-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (3R)-3-(difluoromethyl)-1-(furan-2-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129349310 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (3R)-3-(difluoromethyl)-1-(furan-2-ylmethyl)pyrrolidin-3-ol |
| SMILES | O[C@]1(C(F)F)CCN(Cc2ccco2)C1 |
| InChI | InChI=1S/C10H13F2NO2/c11-9(12)10(14)3-4-13(7-10)6-8-2-1-5-15-8/h1-2,5,9,14H,3-4,6-7H2/t10-/m1/s1 |
| InChIKey | FYQXNTYRMXPLIL-SNVBAGLBSA-N |
| XLogP | 1.48 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |