C13H22F3NO3 — CID 129349851
(3R,4R)-3-[(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]oxan-4-ol (PubChem CID 129349851) has the molecular formula C13H22F3NO3 and a molecular weight of 297.32 g/mol. Its IUPAC name is (3R,4R)-3-[(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]oxan-4-ol.
| Compound Name | (3R,4R)-3-[(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]oxan-4-ol |
|---|---|
| PubChem CID | 129349851 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (3R,4R)-3-[(2R)-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]oxan-4-ol |
| SMILES | O[C@@H]1CCOC[C@H]1[C@H]1CCCN1CCOCC(F)(F)F |
| InChI | InChI=1S/C13H22F3NO3/c14-13(15,16)9-20-7-5-17-4-1-2-11(17)10-8-19-6-3-12(10)18/h10-12,18H,1-9H2/t10-,11+,12+/m0/s1 |
| InChIKey | VQHUWFQSGRVSHD-QJPTWQEYSA-N |
| XLogP | 1.43 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|