C19H29NO3 — CID 129447443
(3R,4R)-3-[(2R)-1-[2-(3-ethylphenoxy)ethyl]pyrrolidin-2-yl]oxan-4-ol (PubChem CID 129447443) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is (3R,4R)-3-[(2R)-1-[2-(3-ethylphenoxy)ethyl]pyrrolidin-2-yl]oxan-4-ol.
| Compound Name | (3R,4R)-3-[(2R)-1-[2-(3-ethylphenoxy)ethyl]pyrrolidin-2-yl]oxan-4-ol |
|---|---|
| PubChem CID | 129447443 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (3R,4R)-3-[(2R)-1-[2-(3-ethylphenoxy)ethyl]pyrrolidin-2-yl]oxan-4-ol |
| SMILES | CCc1cccc(OCCN2CCC[C@@H]2[C@@H]2COCC[C@H]2O)c1 |
| InChI | InChI=1S/C19H29NO3/c1-2-15-5-3-6-16(13-15)23-12-10-20-9-4-7-18(20)17-14-22-11-8-19(17)21/h3,5-6,13,17-19,21H,2,4,7-12,14H2,1H3/t17-,18+,19+/m0/s1 |
| InChIKey | NCXJTAYQSJVUIF-IPMKNSEASA-N |
| XLogP | 2.49 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |