C18H22N4O3 — CID 129350078
(5R)-N-(2-but-3-enylphenyl)-3-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7-carboxamide (PubChem CID 129350078) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is (5R)-N-(2-but-3-enylphenyl)-3-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7-carboxamide.
| Compound Name | (5R)-N-(2-but-3-enylphenyl)-3-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7-carboxamide |
|---|---|
| PubChem CID | 129350078 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (5R)-N-(2-but-3-enylphenyl)-3-methyl-2,4-dioxo-1,3,7-triazaspiro[4.4]nonane-7-carboxamide |
| SMILES | C=CCCc1ccccc1NC(=O)N1CC[C@]2(C1)NC(=O)N(C)C2=O |
| InChI | InChI=1S/C18H22N4O3/c1-3-4-7-13-8-5-6-9-14(13)19-16(24)22-11-10-18(12-22)15(23)21(2)17(25)20-18/h3,5-6,8-9H,1,4,7,10-12H2,2H3,(H,19,24)(H,20,25)/t18-/m1/s1 |
| InChIKey | BPBNNHZPGDYKFT-GOSISDBHSA-N |
| XLogP | 1.96 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|