C22H21F3N4O3 — CID 27558311
3-benzyl-2,4-dioxo-N-[2-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide (PubChem CID 27558311) has the molecular formula C22H21F3N4O3 and a molecular weight of 446.43 g/mol. Its IUPAC name is 3-benzyl-2,4-dioxo-N-[2-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide.
| Compound Name | 3-benzyl-2,4-dioxo-N-[2-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 27558311 |
| Molecular Formula | C22H21F3N4O3 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 3-benzyl-2,4-dioxo-N-[2-(trifluoromethyl)phenyl]-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)N1CCC2(CC1)NC(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C22H21F3N4O3/c23-22(24,25)16-8-4-5-9-17(16)26-19(31)28-12-10-21(11-13-28)18(30)29(20(32)27-21)14-15-6-2-1-3-7-15/h1-9H,10-14H2,(H,26,31)(H,27,32) |
| InChIKey | NZXPNHPDQATKPW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|