C21H19ClF2N4O3 — CID 42109537
N-(3-chloro-4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide (PubChem CID 42109537) has the molecular formula C21H19ClF2N4O3 and a molecular weight of 448.86 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 42109537 |
| Molecular Formula | C21H19ClF2N4O3 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)N1CCC2(CC1)NC(=O)N(Cc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C21H19ClF2N4O3/c22-16-11-15(5-6-17(16)24)25-19(30)27-9-7-21(8-10-27)18(29)28(20(31)26-21)12-13-1-3-14(23)4-2-13/h1-6,11H,7-10,12H2,(H,25,30)(H,26,31) |
| InChIKey | SCUDXGOHZDGOIJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|