C15H17Cl2N3O3S — CID 129356355
2,5-dichloro-N-[1-[[(2S)-oxan-2-yl]methyl]pyrazol-4-yl]benzenesulfonamide (PubChem CID 129356355) has the molecular formula C15H17Cl2N3O3S and a molecular weight of 390.29 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-[[(2S)-oxan-2-yl]methyl]pyrazol-4-yl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[1-[[(2S)-oxan-2-yl]methyl]pyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 129356355 |
| Molecular Formula | C15H17Cl2N3O3S |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2,5-dichloro-N-[1-[[(2S)-oxan-2-yl]methyl]pyrazol-4-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cnn(C[C@@H]2CCCCO2)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H17Cl2N3O3S/c16-11-4-5-14(17)15(7-11)24(21,22)19-12-8-18-20(9-12)10-13-3-1-2-6-23-13/h4-5,7-9,13,19H,1-3,6,10H2/t13-/m0/s1 |
| InChIKey | XQADCZCQCNEAPO-ZDUSSCGKSA-N |
| XLogP | 3.56 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |