C17H22FN3O4S — CID 121145415
4-ethoxy-3-fluoro-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzenesulfonamide (PubChem CID 121145415) has the molecular formula C17H22FN3O4S and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-ethoxy-3-fluoro-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzenesulfonamide.
| Compound Name | 4-ethoxy-3-fluoro-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 121145415 |
| Molecular Formula | C17H22FN3O4S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-ethoxy-3-fluoro-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cnn(CC3CCCCO3)c2)cc1F |
| InChI | InChI=1S/C17H22FN3O4S/c1-2-24-17-7-6-15(9-16(17)18)26(22,23)20-13-10-19-21(11-13)12-14-5-3-4-8-25-14/h6-7,9-11,14,20H,2-5,8,12H2,1H3 |
| InChIKey | LTZNBUOOUFDYCH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |