C18H25N3O4S — CID 90622466
4-ethoxy-3-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzenesulfonamide (PubChem CID 90622466) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-ethoxy-3-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzenesulfonamide.
| Compound Name | 4-ethoxy-3-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90622466 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-ethoxy-3-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cnn(CC3CCOCC3)c2)cc1C |
| InChI | InChI=1S/C18H25N3O4S/c1-3-25-18-5-4-17(10-14(18)2)26(22,23)20-16-11-19-21(13-16)12-15-6-8-24-9-7-15/h4-5,10-11,13,15,20H,3,6-9,12H2,1-2H3 |
| InChIKey | ANIIGMFQYSVQDJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |