C16H21N3O4S — CID 90597852
4-methoxy-3-methyl-N-[1-(oxan-4-yl)pyrazol-4-yl]benzenesulfonamide (PubChem CID 90597852) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 4-methoxy-3-methyl-N-[1-(oxan-4-yl)pyrazol-4-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-3-methyl-N-[1-(oxan-4-yl)pyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90597852 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-methoxy-3-methyl-N-[1-(oxan-4-yl)pyrazol-4-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cnn(C3CCOCC3)c2)cc1C |
| InChI | InChI=1S/C16H21N3O4S/c1-12-9-15(3-4-16(12)22-2)24(20,21)18-13-10-17-19(11-13)14-5-7-23-8-6-14/h3-4,9-11,14,18H,5-8H2,1-2H3 |
| InChIKey | HBPNWELTYLMWFU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |