C17H23N3O4S — CID 90622401
4-methoxy-3-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzenesulfonamide (PubChem CID 90622401) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 4-methoxy-3-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-3-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90622401 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-methoxy-3-methyl-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cnn(CC3CCOCC3)c2)cc1C |
| InChI | InChI=1S/C17H23N3O4S/c1-13-9-16(3-4-17(13)23-2)25(21,22)19-15-10-18-20(12-15)11-14-5-7-24-8-6-14/h3-4,9-10,12,14,19H,5-8,11H2,1-2H3 |
| InChIKey | BQUVNPWDVFEZDQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |