C13H16BrN3O3S2 — CID 90622453
5-bromo-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]thiophene-2-sulfonamide (PubChem CID 90622453) has the molecular formula C13H16BrN3O3S2 and a molecular weight of 406.33 g/mol. Its IUPAC name is 5-bromo-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90622453 |
| Molecular Formula | C13H16BrN3O3S2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 5-bromo-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cnn(CC2CCOCC2)c1)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H16BrN3O3S2/c14-12-1-2-13(21-12)22(18,19)16-11-7-15-17(9-11)8-10-3-5-20-6-4-10/h1-2,7,9-10,16H,3-6,8H2 |
| InChIKey | QPAOXNCMSNXFDC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |