C15H19NO2S — CID 129358251
N-[(2S)-4-(5-methylfuran-2-yl)butan-2-yl]-2-thiophen-3-ylacetamide (PubChem CID 129358251) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is N-[(2S)-4-(5-methylfuran-2-yl)butan-2-yl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[(2S)-4-(5-methylfuran-2-yl)butan-2-yl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 129358251 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-[(2S)-4-(5-methylfuran-2-yl)butan-2-yl]-2-thiophen-3-ylacetamide |
| SMILES | Cc1ccc(CC[C@H](C)NC(=O)Cc2ccsc2)o1 |
| InChI | InChI=1S/C15H19NO2S/c1-11(3-5-14-6-4-12(2)18-14)16-15(17)9-13-7-8-19-10-13/h4,6-8,10-11H,3,5,9H2,1-2H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | FJBAVGHXWOTABX-NSHDSACASA-N |
| XLogP | 3.33 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |